C15H24O5 — CID 70353392
ethyl (1R,3S,4S,5S,6R,7R)-6-methoxy-9,9-dimethyl-2,8-dioxatricyclo[5.4.0.03,5]undecane-4-carboxylate (PubChem CID 70353392) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is ethyl (1R,3S,4S,5S,6R,7R)-6-methoxy-9,9-dimethyl-2,8-dioxatricyclo[5.4.0.03,5]undecane-4-carboxylate.
| Compound Name | ethyl (1R,3S,4S,5S,6R,7R)-6-methoxy-9,9-dimethyl-2,8-dioxatricyclo[5.4.0.03,5]undecane-4-carboxylate |
|---|---|
| PubChem CID | 70353392 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | ethyl (1R,3S,4S,5S,6R,7R)-6-methoxy-9,9-dimethyl-2,8-dioxatricyclo[5.4.0.03,5]undecane-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2O[C@@H]3CCC(C)(C)O[C@H]3[C@H](OC)[C@H]21 |
| InChI | InChI=1S/C15H24O5/c1-5-18-14(16)10-9-12(10)19-8-6-7-15(2,3)20-11(8)13(9)17-4/h8-13H,5-7H2,1-4H3/t8-,9+,10+,11-,12+,13-/m1/s1 |
| InChIKey | CHGXDQKTJMIWSL-ZEPSMKPISA-N |
| XLogP | 1.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |