C18H14Cl2N2O3 — CID 7035340
3,4-dichloro-N-[(1R,2S,6S,7S,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzamide (PubChem CID 7035340) has the molecular formula C18H14Cl2N2O3 and a molecular weight of 377.23 g/mol. Its IUPAC name is 3,4-dichloro-N-[(1R,2S,6S,7S,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[(1R,2S,6S,7S,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzamide |
|---|---|
| PubChem CID | 7035340 |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 3,4-dichloro-N-[(1R,2S,6S,7S,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzamide |
| SMILES | O=C(NN1C(=O)[C@H]2[C@@H]3C=C[C@@H]([C@H]4C[C@H]34)[C@@H]2C1=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2N2O3/c19-12-4-1-7(5-13(12)20)16(23)21-22-17(24)14-8-2-3-9(11-6-10(8)11)15(14)18(22)25/h1-5,8-11,14-15H,6H2,(H,21,23)/t8-,9+,10-,11-,14+,15+/m1/s1 |
| InChIKey | YEFCTMCIJSAHED-MTYIDNOTSA-N |
| XLogP | 2.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|