About (1S,2S)-1-[3-(2-trityltetrazol-5-yl)phenyl]propane-1,2-diol
(1S,2S)-1-[3-(2-trityltetrazol-5-yl)phenyl]propane-1,2-diol (PubChem CID 70353435) has the molecular formula C29H26N4O2
and a molecular weight of 462.55 g/mol. Its IUPAC name is (1S,2S)-1-[3-(2-trityltetrazol-5-yl)phenyl]propane-1,2-diol.
Molecular Properties
| Compound Name | (1S,2S)-1-[3-(2-trityltetrazol-5-yl)phenyl]propane-1,2-diol |
| PubChem CID | 70353435 |
| Molecular Formula | C29H26N4O2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | (1S,2S)-1-[3-(2-trityltetrazol-5-yl)phenyl]propane-1,2-diol |
| SMILES | C[C@H](O)[C@@H](O)c1cccc(-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)c1 |
| InChI | InChI=1S/C29H26N4O2/c1-21(34)27(35)22-12-11-13-23(20-22)28-30-32-33(31-28)29(24-14-5-2-6-15-24,25-16-7-3-8-17-25)26-18-9-4-10-19-26/h2-21,27,34-35H,1H3/t21-,27+/m0/s1 |
| InChIKey | MZQCFUARILPXCM-KDYSTLNUSA-N |
| XLogP | 4.59 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (1S,2S)-1-[3-(2-trityltetrazol-5-yl)phenyl]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-1-[3-(2-trityltetrazol-5-yl)phenyl]propane-1,2-diol?
The IUPAC name of (1S,2S)-1-[3-(2-trityltetrazol-5-yl)phenyl]propane-1,2-diol (CID 70353435) is (1S,2S)-1-[3-(2-trityltetrazol-5-yl)phenyl]propane-1,2-diol.
What is the SMILES notation for (1S,2S)-1-[3-(2-trityltetrazol-5-yl)phenyl]propane-1,2-diol?
The canonical SMILES for (1S,2S)-1-[3-(2-trityltetrazol-5-yl)phenyl]propane-1,2-diol is C[C@H](O)[C@@H](O)c1cccc(-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)c1.
What is the InChIKey of (1S,2S)-1-[3-(2-trityltetrazol-5-yl)phenyl]propane-1,2-diol?
The InChIKey is MZQCFUARILPXCM-KDYSTLNUSA-N. The full InChI is InChI=1S/C29H26N4O2/c1-21(34)27(35)22-12-11-13-23(20-22)28-30-32-33(31-28)29(24-14-5-2-6-15-24,25-16-7-3-8-17-25)26-18-9-4-10-19-26/h2-21,27,34-35H,1H3/t21-,27+/m0/s1.
What are the key properties of (1S,2S)-1-[3-(2-trityltetrazol-5-yl)phenyl]propane-1,2-diol?
(1S,2S)-1-[3-(2-trityltetrazol-5-yl)phenyl]propane-1,2-diol has a molecular weight of 462.55 g/mol, XLogP of 4.59, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-1-[3-(2-trityltetrazol-5-yl)phenyl]propane-1,2-diol is sourced from PubChem (CID 70353435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).