About 3-[1-[4-(1,2-benzothiazol-3-yl)piperidin-1-yl]prop-2-enyl]-6-fluoro-1,2-benzoxazole
3-[1-[4-(1,2-benzothiazol-3-yl)piperidin-1-yl]prop-2-enyl]-6-fluoro-1,2-benzoxazole (PubChem CID 70353458) has the molecular formula C22H20FN3OS
and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-[1-[4-(1,2-benzothiazol-3-yl)piperidin-1-yl]prop-2-enyl]-6-fluoro-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-[1-[4-(1,2-benzothiazol-3-yl)piperidin-1-yl]prop-2-enyl]-6-fluoro-1,2-benzoxazole |
| PubChem CID | 70353458 |
| Molecular Formula | C22H20FN3OS |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 3-[1-[4-(1,2-benzothiazol-3-yl)piperidin-1-yl]prop-2-enyl]-6-fluoro-1,2-benzoxazole |
| SMILES | C=CC(c1noc2cc(F)ccc12)N1CCC(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C22H20FN3OS/c1-2-18(22-16-8-7-15(23)13-19(16)27-24-22)26-11-9-14(10-12-26)21-17-5-3-4-6-20(17)28-25-21/h2-8,13-14,18H,1,9-12H2 |
| InChIKey | LSLIUADLVKNNEP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-[4-(1,2-benzothiazol-3-yl)piperidin-1-yl]prop-2-enyl]-6-fluoro-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[4-(1,2-benzothiazol-3-yl)piperidin-1-yl]prop-2-enyl]-6-fluoro-1,2-benzoxazole?
The IUPAC name of 3-[1-[4-(1,2-benzothiazol-3-yl)piperidin-1-yl]prop-2-enyl]-6-fluoro-1,2-benzoxazole (CID 70353458) is 3-[1-[4-(1,2-benzothiazol-3-yl)piperidin-1-yl]prop-2-enyl]-6-fluoro-1,2-benzoxazole.
What is the SMILES notation for 3-[1-[4-(1,2-benzothiazol-3-yl)piperidin-1-yl]prop-2-enyl]-6-fluoro-1,2-benzoxazole?
The canonical SMILES for 3-[1-[4-(1,2-benzothiazol-3-yl)piperidin-1-yl]prop-2-enyl]-6-fluoro-1,2-benzoxazole is C=CC(c1noc2cc(F)ccc12)N1CCC(c2nsc3ccccc23)CC1.
What is the InChIKey of 3-[1-[4-(1,2-benzothiazol-3-yl)piperidin-1-yl]prop-2-enyl]-6-fluoro-1,2-benzoxazole?
The InChIKey is LSLIUADLVKNNEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20FN3OS/c1-2-18(22-16-8-7-15(23)13-19(16)27-24-22)26-11-9-14(10-12-26)21-17-5-3-4-6-20(17)28-25-21/h2-8,13-14,18H,1,9-12H2.
What are the key properties of 3-[1-[4-(1,2-benzothiazol-3-yl)piperidin-1-yl]prop-2-enyl]-6-fluoro-1,2-benzoxazole?
3-[1-[4-(1,2-benzothiazol-3-yl)piperidin-1-yl]prop-2-enyl]-6-fluoro-1,2-benzoxazole has a molecular weight of 393.49 g/mol, XLogP of 5.68, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[4-(1,2-benzothiazol-3-yl)piperidin-1-yl]prop-2-enyl]-6-fluoro-1,2-benzoxazole is sourced from PubChem (CID 70353458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).