C19H22N4O4S — CID 70353459
N-[4-(7,7-dimethyl-6-oxo-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazol-2-yl)-3-methoxyphenyl]methanesulfonamide (PubChem CID 70353459) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is N-[4-(7,7-dimethyl-6-oxo-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazol-2-yl)-3-methoxyphenyl]methanesulfonamide.
| Compound Name | N-[4-(7,7-dimethyl-6-oxo-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazol-2-yl)-3-methoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70353459 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[4-(7,7-dimethyl-6-oxo-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazol-2-yl)-3-methoxyphenyl]methanesulfonamide |
| SMILES | COc1cc(NS(C)(=O)=O)ccc1C1Nc2cc3c(cc2N1)C(C)(C)C(=O)N3 |
| InChI | InChI=1S/C19H22N4O4S/c1-19(2)12-8-14-15(9-13(12)22-18(19)24)21-17(20-14)11-6-5-10(7-16(11)27-3)23-28(4,25)26/h5-9,17,20-21,23H,1-4H3,(H,22,24) |
| InChIKey | WEGXIQHQQKMDTI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |