About 2-amino-N-butyl-3,6-dihydro-2H-pyridine-1-carboxamide
2-amino-N-butyl-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 70353666) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-amino-N-butyl-3,6-dihydro-2H-pyridine-1-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N-butyl-3,6-dihydro-2H-pyridine-1-carboxamide |
| PubChem CID | 70353666 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-amino-N-butyl-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CC=CCC1N |
| InChI | InChI=1S/C10H19N3O/c1-2-3-7-12-10(14)13-8-5-4-6-9(13)11/h4-5,9H,2-3,6-8,11H2,1H3,(H,12,14) |
| InChIKey | YCLSLMXJZVXLDB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-butyl-3,6-dihydro-2H-pyridine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-butyl-3,6-dihydro-2H-pyridine-1-carboxamide?
The IUPAC name of 2-amino-N-butyl-3,6-dihydro-2H-pyridine-1-carboxamide (CID 70353666) is 2-amino-N-butyl-3,6-dihydro-2H-pyridine-1-carboxamide.
What is the SMILES notation for 2-amino-N-butyl-3,6-dihydro-2H-pyridine-1-carboxamide?
The canonical SMILES for 2-amino-N-butyl-3,6-dihydro-2H-pyridine-1-carboxamide is CCCCNC(=O)N1CC=CCC1N.
What is the InChIKey of 2-amino-N-butyl-3,6-dihydro-2H-pyridine-1-carboxamide?
The InChIKey is YCLSLMXJZVXLDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O/c1-2-3-7-12-10(14)13-8-5-4-6-9(13)11/h4-5,9H,2-3,6-8,11H2,1H3,(H,12,14).
What are the key properties of 2-amino-N-butyl-3,6-dihydro-2H-pyridine-1-carboxamide?
2-amino-N-butyl-3,6-dihydro-2H-pyridine-1-carboxamide has a molecular weight of 197.28 g/mol, XLogP of 1.04, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-butyl-3,6-dihydro-2H-pyridine-1-carboxamide is sourced from PubChem (CID 70353666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).