C15H21ClINO2 — CID 70353714
2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-iodo-3-methoxypropan-2-yl)acetamide (PubChem CID 70353714) has the molecular formula C15H21ClINO2 and a molecular weight of 409.70 g/mol. Its IUPAC name is 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-iodo-3-methoxypropan-2-yl)acetamide.
| Compound Name | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-iodo-3-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 70353714 |
| Molecular Formula | C15H21ClINO2 |
| Molecular Weight | 409.70 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-iodo-3-methoxypropan-2-yl)acetamide |
| SMILES | CCc1cccc(C)c1N(C(=O)CCl)C(CI)COC |
| InChI | InChI=1S/C15H21ClINO2/c1-4-12-7-5-6-11(2)15(12)18(14(19)8-16)13(9-17)10-20-3/h5-7,13H,4,8-10H2,1-3H3 |
| InChIKey | FFJVCISLJJAYHI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.70 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|