C33H38O6 — CID 70354009
(1S,2R,3R,4S,5R,6R)-1,3,4-tribenzyl-2,5-bis(prop-2-enyl)cyclohexane-1,2,3,4,5,6-hexol (PubChem CID 70354009) has the molecular formula C33H38O6 and a molecular weight of 530.66 g/mol. Its IUPAC name is (1S,2R,3R,4S,5R,6R)-1,3,4-tribenzyl-2,5-bis(prop-2-enyl)cyclohexane-1,2,3,4,5,6-hexol.
| Compound Name | (1S,2R,3R,4S,5R,6R)-1,3,4-tribenzyl-2,5-bis(prop-2-enyl)cyclohexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 70354009 |
| Molecular Formula | C33H38O6 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | (1S,2R,3R,4S,5R,6R)-1,3,4-tribenzyl-2,5-bis(prop-2-enyl)cyclohexane-1,2,3,4,5,6-hexol |
| SMILES | C=CC[C@]1(O)[C@](O)(Cc2ccccc2)[C@](O)(Cc2ccccc2)[C@@](O)(CC=C)[C@@H](O)[C@@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C33H38O6/c1-3-20-29(35)28(34)30(36,22-25-14-8-5-9-15-25)31(37,21-4-2)33(39,24-27-18-12-7-13-19-27)32(29,38)23-26-16-10-6-11-17-26/h3-19,28,34-39H,1-2,20-24H2/t28-,29-,30+,31-,32+,33-/m1/s1 |
| InChIKey | XMZWAZXXQPJDCQ-BFZJMCNQSA-N |
| XLogP | 2.90 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|