About 5-butoxyindol-2-one
5-butoxyindol-2-one (PubChem CID 70354099) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 5-butoxyindol-2-one.
Molecular Properties
| Compound Name | 5-butoxyindol-2-one |
| PubChem CID | 70354099 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 5-butoxyindol-2-one |
| SMILES | CCCCOc1ccc2c(c1)=CC(=O)N=2 |
| InChI | InChI=1S/C12H13NO2/c1-2-3-6-15-10-4-5-11-9(7-10)8-12(14)13-11/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | NRJAVARFGXYSNA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxyindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxyindol-2-one?
The IUPAC name of 5-butoxyindol-2-one (CID 70354099) is 5-butoxyindol-2-one.
What is the SMILES notation for 5-butoxyindol-2-one?
The canonical SMILES for 5-butoxyindol-2-one is CCCCOc1ccc2c(c1)=CC(=O)N=2.
What is the InChIKey of 5-butoxyindol-2-one?
The InChIKey is NRJAVARFGXYSNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-2-3-6-15-10-4-5-11-9(7-10)8-12(14)13-11/h4-5,7-8H,2-3,6H2,1H3.
What are the key properties of 5-butoxyindol-2-one?
5-butoxyindol-2-one has a molecular weight of 203.24 g/mol, XLogP of 0.81, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxyindol-2-one is sourced from PubChem (CID 70354099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).