About 6-pentyl-11H-pyrido[2,3-i][1,4]benzodiazepine
6-pentyl-11H-pyrido[2,3-i][1,4]benzodiazepine (PubChem CID 70354179) has the molecular formula C17H19N3
and a molecular weight of 265.36 g/mol. Its IUPAC name is 6-pentyl-11H-pyrido[2,3-i][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 6-pentyl-11H-pyrido[2,3-i][1,4]benzodiazepine |
| PubChem CID | 70354179 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 6-pentyl-11H-pyrido[2,3-i][1,4]benzodiazepine |
| SMILES | CCCCCc1cc2c(c3c1=CN=CC=N3)CC=CN=2 |
| InChI | InChI=1S/C17H19N3/c1-2-3-4-6-13-11-16-14(7-5-8-19-16)17-15(13)12-18-9-10-20-17/h5,8-12H,2-4,6-7H2,1H3 |
| InChIKey | WNZWKSIFPUXSCG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-pentyl-11H-pyrido[2,3-i][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pentyl-11H-pyrido[2,3-i][1,4]benzodiazepine?
The IUPAC name of 6-pentyl-11H-pyrido[2,3-i][1,4]benzodiazepine (CID 70354179) is 6-pentyl-11H-pyrido[2,3-i][1,4]benzodiazepine.
What is the SMILES notation for 6-pentyl-11H-pyrido[2,3-i][1,4]benzodiazepine?
The canonical SMILES for 6-pentyl-11H-pyrido[2,3-i][1,4]benzodiazepine is CCCCCc1cc2c(c3c1=CN=CC=N3)CC=CN=2.
What is the InChIKey of 6-pentyl-11H-pyrido[2,3-i][1,4]benzodiazepine?
The InChIKey is WNZWKSIFPUXSCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3/c1-2-3-4-6-13-11-16-14(7-5-8-19-16)17-15(13)12-18-9-10-20-17/h5,8-12H,2-4,6-7H2,1H3.
What are the key properties of 6-pentyl-11H-pyrido[2,3-i][1,4]benzodiazepine?
6-pentyl-11H-pyrido[2,3-i][1,4]benzodiazepine has a molecular weight of 265.36 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pentyl-11H-pyrido[2,3-i][1,4]benzodiazepine is sourced from PubChem (CID 70354179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).