C24H28N6O7 — CID 70354529
methyl [7-methyl-2,4-dimorpholin-4-yl-5-(4-nitrophenyl)-5,8-dihydropyrido[2,3-d]pyrimidin-6-yl] carbonate (PubChem CID 70354529) has the molecular formula C24H28N6O7 and a molecular weight of 512.52 g/mol. Its IUPAC name is methyl [7-methyl-2,4-dimorpholin-4-yl-5-(4-nitrophenyl)-5,8-dihydropyrido[2,3-d]pyrimidin-6-yl] carbonate.
| Compound Name | methyl [7-methyl-2,4-dimorpholin-4-yl-5-(4-nitrophenyl)-5,8-dihydropyrido[2,3-d]pyrimidin-6-yl] carbonate |
|---|---|
| PubChem CID | 70354529 |
| Molecular Formula | C24H28N6O7 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | methyl [7-methyl-2,4-dimorpholin-4-yl-5-(4-nitrophenyl)-5,8-dihydropyrido[2,3-d]pyrimidin-6-yl] carbonate |
| SMILES | COC(=O)OC1=C(C)Nc2nc(N3CCOCC3)nc(N3CCOCC3)c2C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H28N6O7/c1-15-20(37-24(31)34-2)18(16-3-5-17(6-4-16)30(32)33)19-21(25-15)26-23(29-9-13-36-14-10-29)27-22(19)28-7-11-35-12-8-28/h3-6,18H,7-14H2,1-2H3,(H,25,26,27) |
| InChIKey | BMIDQWGOWRLGIO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 141.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|