About (5-amino-2,6-dimethyl-4-propan-2-yl-1,4-dihydropyridin-3-yl) methyl carbonate
(5-amino-2,6-dimethyl-4-propan-2-yl-1,4-dihydropyridin-3-yl) methyl carbonate (PubChem CID 70354795) has the molecular formula C12H20N2O3
and a molecular weight of 240.30 g/mol. Its IUPAC name is (5-amino-2,6-dimethyl-4-propan-2-yl-1,4-dihydropyridin-3-yl) methyl carbonate.
Molecular Properties
| Compound Name | (5-amino-2,6-dimethyl-4-propan-2-yl-1,4-dihydropyridin-3-yl) methyl carbonate |
| PubChem CID | 70354795 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (5-amino-2,6-dimethyl-4-propan-2-yl-1,4-dihydropyridin-3-yl) methyl carbonate |
| SMILES | COC(=O)OC1=C(C)NC(C)=C(N)C1C(C)C |
| InChI | InChI=1S/C12H20N2O3/c1-6(2)9-10(13)7(3)14-8(4)11(9)17-12(15)16-5/h6,9,14H,13H2,1-5H3 |
| InChIKey | KMZHXURLSBYHGI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-amino-2,6-dimethyl-4-propan-2-yl-1,4-dihydropyridin-3-yl) methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-2,6-dimethyl-4-propan-2-yl-1,4-dihydropyridin-3-yl) methyl carbonate?
The IUPAC name of (5-amino-2,6-dimethyl-4-propan-2-yl-1,4-dihydropyridin-3-yl) methyl carbonate (CID 70354795) is (5-amino-2,6-dimethyl-4-propan-2-yl-1,4-dihydropyridin-3-yl) methyl carbonate.
What is the SMILES notation for (5-amino-2,6-dimethyl-4-propan-2-yl-1,4-dihydropyridin-3-yl) methyl carbonate?
The canonical SMILES for (5-amino-2,6-dimethyl-4-propan-2-yl-1,4-dihydropyridin-3-yl) methyl carbonate is COC(=O)OC1=C(C)NC(C)=C(N)C1C(C)C.
What is the InChIKey of (5-amino-2,6-dimethyl-4-propan-2-yl-1,4-dihydropyridin-3-yl) methyl carbonate?
The InChIKey is KMZHXURLSBYHGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O3/c1-6(2)9-10(13)7(3)14-8(4)11(9)17-12(15)16-5/h6,9,14H,13H2,1-5H3.
What are the key properties of (5-amino-2,6-dimethyl-4-propan-2-yl-1,4-dihydropyridin-3-yl) methyl carbonate?
(5-amino-2,6-dimethyl-4-propan-2-yl-1,4-dihydropyridin-3-yl) methyl carbonate has a molecular weight of 240.30 g/mol, XLogP of 2.07, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-2,6-dimethyl-4-propan-2-yl-1,4-dihydropyridin-3-yl) methyl carbonate is sourced from PubChem (CID 70354795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).