C12H24O3Si — CID 70355099
(2S,3R,4S)-6-[butyl(dimethyl)silyl]-2-methyl-3,4-dihydro-2H-pyran-3,4-diol (PubChem CID 70355099) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is (2S,3R,4S)-6-[butyl(dimethyl)silyl]-2-methyl-3,4-dihydro-2H-pyran-3,4-diol.
| Compound Name | (2S,3R,4S)-6-[butyl(dimethyl)silyl]-2-methyl-3,4-dihydro-2H-pyran-3,4-diol |
|---|---|
| PubChem CID | 70355099 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (2S,3R,4S)-6-[butyl(dimethyl)silyl]-2-methyl-3,4-dihydro-2H-pyran-3,4-diol |
| SMILES | CCCC[Si](C)(C)C1=C[C@H](O)[C@@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C12H24O3Si/c1-5-6-7-16(3,4)11-8-10(13)12(14)9(2)15-11/h8-10,12-14H,5-7H2,1-4H3/t9-,10-,12-/m0/s1 |
| InChIKey | WJZGYFFBYNBGDY-NHCYSSNCSA-N |
| XLogP | 2.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|