About 3,6-bis(difluoromethoxy)benzene-1,2-dicarbonitrile
3,6-bis(difluoromethoxy)benzene-1,2-dicarbonitrile (PubChem CID 70355143) has the molecular formula C10H4F4N2O2
and a molecular weight of 260.15 g/mol. Its IUPAC name is 3,6-bis(difluoromethoxy)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 3,6-bis(difluoromethoxy)benzene-1,2-dicarbonitrile |
| PubChem CID | 70355143 |
| Molecular Formula | C10H4F4N2O2 |
| Molecular Weight | 260.15 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 3,6-bis(difluoromethoxy)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(OC(F)F)ccc(OC(F)F)c1C#N |
| InChI | InChI=1S/C10H4F4N2O2/c11-9(12)17-7-1-2-8(18-10(13)14)6(4-16)5(7)3-15/h1-2,9-10H |
| InChIKey | YKFYMXYZDQSYML-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.15 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,6-bis(difluoromethoxy)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-bis(difluoromethoxy)benzene-1,2-dicarbonitrile?
The IUPAC name of 3,6-bis(difluoromethoxy)benzene-1,2-dicarbonitrile (CID 70355143) is 3,6-bis(difluoromethoxy)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 3,6-bis(difluoromethoxy)benzene-1,2-dicarbonitrile?
The canonical SMILES for 3,6-bis(difluoromethoxy)benzene-1,2-dicarbonitrile is N#Cc1c(OC(F)F)ccc(OC(F)F)c1C#N.
What is the InChIKey of 3,6-bis(difluoromethoxy)benzene-1,2-dicarbonitrile?
The InChIKey is YKFYMXYZDQSYML-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4F4N2O2/c11-9(12)17-7-1-2-8(18-10(13)14)6(4-16)5(7)3-15/h1-2,9-10H.
What are the key properties of 3,6-bis(difluoromethoxy)benzene-1,2-dicarbonitrile?
3,6-bis(difluoromethoxy)benzene-1,2-dicarbonitrile has a molecular weight of 260.15 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-bis(difluoromethoxy)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 70355143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).