C34H31NO5 — CID 70355149
anthracene-9,10-dione;methyl 2-(2,6-dimethyl-N-(2-phenylacetyl)anilino)propanoate (PubChem CID 70355149) has the molecular formula C34H31NO5 and a molecular weight of 533.62 g/mol. Its IUPAC name is anthracene-9,10-dione;methyl 2-(2,6-dimethyl-N-(2-phenylacetyl)anilino)propanoate.
| Compound Name | anthracene-9,10-dione;methyl 2-(2,6-dimethyl-N-(2-phenylacetyl)anilino)propanoate |
|---|---|
| PubChem CID | 70355149 |
| Molecular Formula | C34H31NO5 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | anthracene-9,10-dione;methyl 2-(2,6-dimethyl-N-(2-phenylacetyl)anilino)propanoate |
| SMILES | COC(=O)C(C)N(C(=O)Cc1ccccc1)c1c(C)cccc1C.O=C1c2ccccc2C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H23NO3.C14H8O2/c1-14-9-8-10-15(2)19(14)21(16(3)20(23)24-4)18(22)13-17-11-6-5-7-12-17;15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h5-12,16H,13H2,1-4H3;1-8H |
| InChIKey | LVABDAKYDAHQBY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|