C27H36O — CID 70355292
(8R,9S,10R,13S,14S)-10-[(4-ethenylphenyl)methyl]-13-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 70355292) has the molecular formula C27H36O and a molecular weight of 376.58 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10-[(4-ethenylphenyl)methyl]-13-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,10R,13S,14S)-10-[(4-ethenylphenyl)methyl]-13-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 70355292 |
| Molecular Formula | C27H36O |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10-[(4-ethenylphenyl)methyl]-13-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C=Cc1ccc(C[C@]23CCCCC2CC[C@@H]2[C@@H]3CC[C@]3(C)C(=O)CC[C@@H]23)cc1 |
| InChI | InChI=1S/C27H36O/c1-3-19-7-9-20(10-8-19)18-27-16-5-4-6-21(27)11-12-22-23-13-14-25(28)26(23,2)17-15-24(22)27/h3,7-10,21-24H,1,4-6,11-18H2,2H3/t21?,22-,23-,24-,26-,27+/m0/s1 |
| InChIKey | NADIEJRTNKYEGN-UPVPDPAPSA-N |
| XLogP | 6.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |