C23H33ClO4 — CID 70355322
[2-[(8R,9S,10S,13S,14S,17S)-16-chloro-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 70355322) has the molecular formula C23H33ClO4 and a molecular weight of 408.97 g/mol. Its IUPAC name is [2-[(8R,9S,10S,13S,14S,17S)-16-chloro-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8R,9S,10S,13S,14S,17S)-16-chloro-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 70355322 |
| Molecular Formula | C23H33ClO4 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | [2-[(8R,9S,10S,13S,14S,17S)-16-chloro-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@H]1C(Cl)C[C@H]2[C@@H]3CCC4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H33ClO4/c1-13(25)28-12-20(27)21-19(24)11-18-16-5-4-14-10-15(26)6-8-22(14,2)17(16)7-9-23(18,21)3/h14,16-19,21H,4-12H2,1-3H3/t14?,16-,17+,18+,19?,21-,22+,23+/m1/s1 |
| InChIKey | BCRKBNZMBJKCQB-AKBIFEIXSA-N |
| XLogP | 4.56 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|