C22H32O5 — CID 70355756
2-[2-[(5R,6R)-5-hydroxy-6-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propoxy]acetic acid (PubChem CID 70355756) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is 2-[2-[(5R,6R)-5-hydroxy-6-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propoxy]acetic acid.
| Compound Name | 2-[2-[(5R,6R)-5-hydroxy-6-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propoxy]acetic acid |
|---|---|
| PubChem CID | 70355756 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-[2-[(5R,6R)-5-hydroxy-6-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propoxy]acetic acid |
| SMILES | CC#CCC(C)C(O)/C=C/[C@@H]1C2CC(C(C)COCC(=O)O)=CC2C[C@H]1O |
| InChI | InChI=1S/C22H32O5/c1-4-5-6-14(2)20(23)8-7-18-19-10-16(9-17(19)11-21(18)24)15(3)12-27-13-22(25)26/h7-9,14-15,17-21,23-24H,6,10-13H2,1-3H3,(H,25,26)/b8-7+/t14?,15?,17?,18-,19?,20?,21-/m1/s1 |
| InChIKey | XESHFGYCQCFJIV-FMLPWBAYSA-N |
| XLogP | 2.63 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|