C17H29NO5Si — CID 70356134
methyl (4S,5R,6S)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70356134) has the molecular formula C17H29NO5Si and a molecular weight of 355.51 g/mol. Its IUPAC name is methyl (4S,5R,6S)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | methyl (4S,5R,6S)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70356134 |
| Molecular Formula | C17H29NO5Si |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | methyl (4S,5R,6S)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COC(=O)C1C(=O)[C@@H](C)[C@@H]2[C@@H](C(C)O[Si](C)(C)C(C)(C)C)C(=O)N12 |
| InChI | InChI=1S/C17H29NO5Si/c1-9-12-11(10(2)23-24(7,8)17(3,4)5)15(20)18(12)13(14(9)19)16(21)22-6/h9-13H,1-8H3/t9-,10?,11+,12+,13?/m0/s1 |
| InChIKey | CXNACBOLAQLGQZ-FDVIIKHLSA-N |
| XLogP | 1.98 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|