About 8-fluoro-4-methyl-4H-chromeno[3,4-d][1,2]oxazole
8-fluoro-4-methyl-4H-chromeno[3,4-d][1,2]oxazole (PubChem CID 70356219) has the molecular formula C11H8FNO2
and a molecular weight of 205.19 g/mol. Its IUPAC name is 8-fluoro-4-methyl-4H-chromeno[3,4-d][1,2]oxazole.
Molecular Properties
| Compound Name | 8-fluoro-4-methyl-4H-chromeno[3,4-d][1,2]oxazole |
| PubChem CID | 70356219 |
| Molecular Formula | C11H8FNO2 |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 8-fluoro-4-methyl-4H-chromeno[3,4-d][1,2]oxazole |
| SMILES | CC1Oc2ccc(F)cc2-c2oncc21 |
| InChI | InChI=1S/C11H8FNO2/c1-6-9-5-13-15-11(9)8-4-7(12)2-3-10(8)14-6/h2-6H,1H3 |
| InChIKey | XLLBAFQOVJUUGF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-fluoro-4-methyl-4H-chromeno[3,4-d][1,2]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-4-methyl-4H-chromeno[3,4-d][1,2]oxazole?
The IUPAC name of 8-fluoro-4-methyl-4H-chromeno[3,4-d][1,2]oxazole (CID 70356219) is 8-fluoro-4-methyl-4H-chromeno[3,4-d][1,2]oxazole.
What is the SMILES notation for 8-fluoro-4-methyl-4H-chromeno[3,4-d][1,2]oxazole?
The canonical SMILES for 8-fluoro-4-methyl-4H-chromeno[3,4-d][1,2]oxazole is CC1Oc2ccc(F)cc2-c2oncc21.
What is the InChIKey of 8-fluoro-4-methyl-4H-chromeno[3,4-d][1,2]oxazole?
The InChIKey is XLLBAFQOVJUUGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FNO2/c1-6-9-5-13-15-11(9)8-4-7(12)2-3-10(8)14-6/h2-6H,1H3.
What are the key properties of 8-fluoro-4-methyl-4H-chromeno[3,4-d][1,2]oxazole?
8-fluoro-4-methyl-4H-chromeno[3,4-d][1,2]oxazole has a molecular weight of 205.19 g/mol, XLogP of 2.93, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-4-methyl-4H-chromeno[3,4-d][1,2]oxazole is sourced from PubChem (CID 70356219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).