About 6-ethoxy-7H-purine-2,8-diamine
6-ethoxy-7H-purine-2,8-diamine (PubChem CID 70356487) has the molecular formula C7H10N6O
and a molecular weight of 194.20 g/mol. Its IUPAC name is 6-ethoxy-7H-purine-2,8-diamine.
Molecular Properties
| Compound Name | 6-ethoxy-7H-purine-2,8-diamine |
| PubChem CID | 70356487 |
| Molecular Formula | C7H10N6O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 6-ethoxy-7H-purine-2,8-diamine |
| SMILES | CCOc1nc(N)nc2nc(N)[nH]c12 |
| InChI | InChI=1S/C7H10N6O/c1-2-14-5-3-4(11-6(8)10-3)12-7(9)13-5/h2H2,1H3,(H5,8,9,10,11,12,13) |
| InChIKey | BSOUWHBFENZBQF-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-ethoxy-7H-purine-2,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-7H-purine-2,8-diamine?
The IUPAC name of 6-ethoxy-7H-purine-2,8-diamine (CID 70356487) is 6-ethoxy-7H-purine-2,8-diamine.
What is the SMILES notation for 6-ethoxy-7H-purine-2,8-diamine?
The canonical SMILES for 6-ethoxy-7H-purine-2,8-diamine is CCOc1nc(N)nc2nc(N)[nH]c12.
What is the InChIKey of 6-ethoxy-7H-purine-2,8-diamine?
The InChIKey is BSOUWHBFENZBQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6O/c1-2-14-5-3-4(11-6(8)10-3)12-7(9)13-5/h2H2,1H3,(H5,8,9,10,11,12,13).
What are the key properties of 6-ethoxy-7H-purine-2,8-diamine?
6-ethoxy-7H-purine-2,8-diamine has a molecular weight of 194.20 g/mol, XLogP of -0.08, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-7H-purine-2,8-diamine is sourced from PubChem (CID 70356487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).