C22H13Cl4O6P — CID 70356527
[2-(3,4-dichlorophenyl)-3-[(3,4-dichlorophenyl)methylidene]-4-oxochromen-6-yl] dihydrogen phosphate (PubChem CID 70356527) has the molecular formula C22H13Cl4O6P and a molecular weight of 546.13 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-3-[(3,4-dichlorophenyl)methylidene]-4-oxochromen-6-yl] dihydrogen phosphate.
| Compound Name | [2-(3,4-dichlorophenyl)-3-[(3,4-dichlorophenyl)methylidene]-4-oxochromen-6-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 70356527 |
| Molecular Formula | C22H13Cl4O6P |
| Molecular Weight | 546.13 g/mol |
| Exact Mass | 543.92 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-3-[(3,4-dichlorophenyl)methylidene]-4-oxochromen-6-yl] dihydrogen phosphate |
| SMILES | O=C1C(=Cc2ccc(Cl)c(Cl)c2)C(c2ccc(Cl)c(Cl)c2)Oc2ccc(OP(=O)(O)O)cc21 |
| InChI | InChI=1S/C22H13Cl4O6P/c23-16-4-1-11(8-18(16)25)7-15-21(27)14-10-13(32-33(28,29)30)3-6-20(14)31-22(15)12-2-5-17(24)19(26)9-12/h1-10,22H,(H2,28,29,30) |
| InChIKey | PJSVXPNIPWHLCA-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.13 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|