About 3-(1,4,5,6-tetrahydropyrimidin-2-yl)propanoic acid;hydrochloride
3-(1,4,5,6-tetrahydropyrimidin-2-yl)propanoic acid;hydrochloride (PubChem CID 70356616) has the molecular formula C7H13ClN2O2
and a molecular weight of 192.65 g/mol. Its IUPAC name is 3-(1,4,5,6-tetrahydropyrimidin-2-yl)propanoic acid;hydrochloride.
Analyze 3-(1,4,5,6-tetrahydropyrimidin-2-yl)propanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4,5,6-tetrahydropyrimidin-2-yl)propanoic acid;hydrochloride?
The IUPAC name of 3-(1,4,5,6-tetrahydropyrimidin-2-yl)propanoic acid;hydrochloride (CID 70356616) is 3-(1,4,5,6-tetrahydropyrimidin-2-yl)propanoic acid;hydrochloride.
What is the SMILES notation for 3-(1,4,5,6-tetrahydropyrimidin-2-yl)propanoic acid;hydrochloride?
The canonical SMILES for 3-(1,4,5,6-tetrahydropyrimidin-2-yl)propanoic acid;hydrochloride is Cl.O=C(O)CCC1=NCCCN1.
What is the InChIKey of 3-(1,4,5,6-tetrahydropyrimidin-2-yl)propanoic acid;hydrochloride?
The InChIKey is IPIVWTZDGCGICJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2.ClH/c10-7(11)3-2-6-8-4-1-5-9-6;/h1-5H2,(H,8,9)(H,10,11);1H.
What are the key properties of 3-(1,4,5,6-tetrahydropyrimidin-2-yl)propanoic acid;hydrochloride?
3-(1,4,5,6-tetrahydropyrimidin-2-yl)propanoic acid;hydrochloride has a molecular weight of 192.65 g/mol, XLogP of 0.66, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4,5,6-tetrahydropyrimidin-2-yl)propanoic acid;hydrochloride is sourced from PubChem (CID 70356616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).