C28H30N2O5 — CID 70356645
benzene-1,2-diol;benzene-1,4-diol;phenol;3-[(2S)-1,2,3,6-tetrahydropyridin-2-yl]pyridine (PubChem CID 70356645) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is benzene-1,2-diol;benzene-1,4-diol;phenol;3-[(2S)-1,2,3,6-tetrahydropyridin-2-yl]pyridine.
| Compound Name | benzene-1,2-diol;benzene-1,4-diol;phenol;3-[(2S)-1,2,3,6-tetrahydropyridin-2-yl]pyridine |
|---|---|
| PubChem CID | 70356645 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | benzene-1,2-diol;benzene-1,4-diol;phenol;3-[(2S)-1,2,3,6-tetrahydropyridin-2-yl]pyridine |
| SMILES | C1=CC[C@@H](c2cccnc2)NC1.Oc1ccc(O)cc1.Oc1ccccc1.Oc1ccccc1O |
| InChI | InChI=1S/C10H12N2.2C6H6O2.C6H6O/c1-2-7-12-10(5-1)9-4-3-6-11-8-9;7-5-1-2-6(8)4-3-5;7-5-3-1-2-4-6(5)8;7-6-4-2-1-3-5-6/h1-4,6,8,10,12H,5,7H2;2*1-4,7-8H;1-5,7H/t10-;;;/m0.../s1 |
| InChIKey | NDDXLGGZGSZKKZ-KAFJHEIMSA-N |
| XLogP | 5.26 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|