About 5-(3-carboxy-1-hexan-3-yloxy-1-oxopropan-2-yl)-3-ethylcyclohex-3-ene-1,2-dicarboxylic acid
5-(3-carboxy-1-hexan-3-yloxy-1-oxopropan-2-yl)-3-ethylcyclohex-3-ene-1,2-dicarboxylic acid (PubChem CID 70356761) has the molecular formula C20H30O8
and a molecular weight of 398.45 g/mol. Its IUPAC name is 5-(3-carboxy-1-hexan-3-yloxy-1-oxopropan-2-yl)-3-ethylcyclohex-3-ene-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | 5-(3-carboxy-1-hexan-3-yloxy-1-oxopropan-2-yl)-3-ethylcyclohex-3-ene-1,2-dicarboxylic acid |
| PubChem CID | 70356761 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 5-(3-carboxy-1-hexan-3-yloxy-1-oxopropan-2-yl)-3-ethylcyclohex-3-ene-1,2-dicarboxylic acid |
| SMILES | CCCC(CC)OC(=O)C(CC(=O)O)C1C=C(CC)C(C(=O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C20H30O8/c1-4-7-13(6-3)28-20(27)14(10-16(21)22)12-8-11(5-2)17(19(25)26)15(9-12)18(23)24/h8,12-15,17H,4-7,9-10H2,1-3H3,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | DXOLZORAJDOUJA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-carboxy-1-hexan-3-yloxy-1-oxopropan-2-yl)-3-ethylcyclohex-3-ene-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-carboxy-1-hexan-3-yloxy-1-oxopropan-2-yl)-3-ethylcyclohex-3-ene-1,2-dicarboxylic acid?
The IUPAC name of 5-(3-carboxy-1-hexan-3-yloxy-1-oxopropan-2-yl)-3-ethylcyclohex-3-ene-1,2-dicarboxylic acid (CID 70356761) is 5-(3-carboxy-1-hexan-3-yloxy-1-oxopropan-2-yl)-3-ethylcyclohex-3-ene-1,2-dicarboxylic acid.
What is the SMILES notation for 5-(3-carboxy-1-hexan-3-yloxy-1-oxopropan-2-yl)-3-ethylcyclohex-3-ene-1,2-dicarboxylic acid?
The canonical SMILES for 5-(3-carboxy-1-hexan-3-yloxy-1-oxopropan-2-yl)-3-ethylcyclohex-3-ene-1,2-dicarboxylic acid is CCCC(CC)OC(=O)C(CC(=O)O)C1C=C(CC)C(C(=O)O)C(C(=O)O)C1.
What is the InChIKey of 5-(3-carboxy-1-hexan-3-yloxy-1-oxopropan-2-yl)-3-ethylcyclohex-3-ene-1,2-dicarboxylic acid?
The InChIKey is DXOLZORAJDOUJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O8/c1-4-7-13(6-3)28-20(27)14(10-16(21)22)12-8-11(5-2)17(19(25)26)15(9-12)18(23)24/h8,12-15,17H,4-7,9-10H2,1-3H3,(H,21,22)(H,23,24)(H,25,26).
What are the key properties of 5-(3-carboxy-1-hexan-3-yloxy-1-oxopropan-2-yl)-3-ethylcyclohex-3-ene-1,2-dicarboxylic acid?
5-(3-carboxy-1-hexan-3-yloxy-1-oxopropan-2-yl)-3-ethylcyclohex-3-ene-1,2-dicarboxylic acid has a molecular weight of 398.45 g/mol, XLogP of 2.96, 11 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-carboxy-1-hexan-3-yloxy-1-oxopropan-2-yl)-3-ethylcyclohex-3-ene-1,2-dicarboxylic acid is sourced from PubChem (CID 70356761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).