About 2-hydroxyethyl 2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]acetate;methane
2-hydroxyethyl 2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]acetate;methane (PubChem CID 70357001) has the molecular formula C17H18ClN3O3
and a molecular weight of 347.80 g/mol. Its IUPAC name is 2-hydroxyethyl 2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]acetate;methane.
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]acetate;methane |
| PubChem CID | 70357001 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-hydroxyethyl 2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]acetate;methane |
| SMILES | C.O=C(Cn1c(-c2ccc(Cl)cc2)nc2cccnc21)OCCO |
| InChI | InChI=1S/C16H14ClN3O3.CH4/c17-12-5-3-11(4-6-12)15-19-13-2-1-7-18-16(13)20(15)10-14(22)23-9-8-21;/h1-7,21H,8-10H2;1H4 |
| InChIKey | ZYHIYBZFWSHRJJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-hydroxyethyl 2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]acetate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]acetate;methane?
The IUPAC name of 2-hydroxyethyl 2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]acetate;methane (CID 70357001) is 2-hydroxyethyl 2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]acetate;methane.
What is the SMILES notation for 2-hydroxyethyl 2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]acetate;methane?
The canonical SMILES for 2-hydroxyethyl 2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]acetate;methane is C.O=C(Cn1c(-c2ccc(Cl)cc2)nc2cccnc21)OCCO.
What is the InChIKey of 2-hydroxyethyl 2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]acetate;methane?
The InChIKey is ZYHIYBZFWSHRJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN3O3.CH4/c17-12-5-3-11(4-6-12)15-19-13-2-1-7-18-16(13)20(15)10-14(22)23-9-8-21;/h1-7,21H,8-10H2;1H4.
What are the key properties of 2-hydroxyethyl 2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]acetate;methane?
2-hydroxyethyl 2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]acetate;methane has a molecular weight of 347.80 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-[2-(4-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]acetate;methane is sourced from PubChem (CID 70357001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).