C23H24ClN5O5 — CID 70357057
but-2-enedioic acid;2-[2-(3-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 70357057) has the molecular formula C23H24ClN5O5 and a molecular weight of 485.93 g/mol. Its IUPAC name is but-2-enedioic acid;2-[2-(3-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | but-2-enedioic acid;2-[2-(3-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 70357057 |
| Molecular Formula | C23H24ClN5O5 |
| Molecular Weight | 485.93 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | but-2-enedioic acid;2-[2-(3-chlorophenyl)imidazo[4,5-b]pyridin-3-yl]-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)Cn2c(-c3cccc(Cl)c3)nc3cccnc32)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C19H20ClN5O.C4H4O4/c1-23-8-10-24(11-9-23)17(26)13-25-18(14-4-2-5-15(20)12-14)22-16-6-3-7-21-19(16)25;5-3(6)1-2-4(7)8/h2-7,12H,8-11,13H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | GKVRROJZUJIEDH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.93 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|