About CID 70357325
CID 70357325 (PubChem CID 70357325) has the molecular formula C5H6K2N2O2S
and a molecular weight of 236.38 g/mol.
Molecular Properties
| Compound Name | CID 70357325 |
| PubChem CID | 70357325 |
| Molecular Formula | C5H6K2N2O2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 235.94 |
| IUPAC Name | — |
| SMILES | CSc1nc(O)cc(=O)[nH]1.[K].[K] |
| InChI | InChI=1S/C5H6N2O2S.2K/c1-10-5-6-3(8)2-4(9)7-5;;/h2H,1H3,(H2,6,7,8,9);; |
| InChIKey | FFABMPYKCPZZGS-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 70357325 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70357325?
The IUPAC name of CID 70357325 (CID 70357325) is not available.
What is the SMILES notation for CID 70357325?
The canonical SMILES for CID 70357325 is CSc1nc(O)cc(=O)[nH]1.[K].[K].
What is the InChIKey of CID 70357325?
The InChIKey is FFABMPYKCPZZGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2S.2K/c1-10-5-6-3(8)2-4(9)7-5;;/h2H,1H3,(H2,6,7,8,9);;.
What are the key properties of CID 70357325?
CID 70357325 has a molecular weight of 236.38 g/mol, XLogP of -0.56, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70357325 is sourced from PubChem (CID 70357325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).