About 1-(3,4,5,6-tetrahydro-2H-1,3-thiazocin-6-yl)ethanone
1-(3,4,5,6-tetrahydro-2H-1,3-thiazocin-6-yl)ethanone (PubChem CID 70358772) has the molecular formula C8H13NOS
and a molecular weight of 171.26 g/mol. Its IUPAC name is 1-(3,4,5,6-tetrahydro-2H-1,3-thiazocin-6-yl)ethanone.
Analyze 1-(3,4,5,6-tetrahydro-2H-1,3-thiazocin-6-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4,5,6-tetrahydro-2H-1,3-thiazocin-6-yl)ethanone?
The IUPAC name of 1-(3,4,5,6-tetrahydro-2H-1,3-thiazocin-6-yl)ethanone (CID 70358772) is 1-(3,4,5,6-tetrahydro-2H-1,3-thiazocin-6-yl)ethanone.
What is the SMILES notation for 1-(3,4,5,6-tetrahydro-2H-1,3-thiazocin-6-yl)ethanone?
The canonical SMILES for 1-(3,4,5,6-tetrahydro-2H-1,3-thiazocin-6-yl)ethanone is CC(=O)C1C=CSCNCC1.
What is the InChIKey of 1-(3,4,5,6-tetrahydro-2H-1,3-thiazocin-6-yl)ethanone?
The InChIKey is BUPZXGPCRDAXBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NOS/c1-7(10)8-2-4-9-6-11-5-3-8/h3,5,8-9H,2,4,6H2,1H3.
What are the key properties of 1-(3,4,5,6-tetrahydro-2H-1,3-thiazocin-6-yl)ethanone?
1-(3,4,5,6-tetrahydro-2H-1,3-thiazocin-6-yl)ethanone has a molecular weight of 171.26 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4,5,6-tetrahydro-2H-1,3-thiazocin-6-yl)ethanone is sourced from PubChem (CID 70358772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).