C22H38O2S — CID 70358951
3,3,6,6-tetramethyl-1-[(3,3,6,6-tetramethylcyclohexen-1-yl)methylsulfonylmethyl]cyclohexene (PubChem CID 70358951) has the molecular formula C22H38O2S and a molecular weight of 366.61 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-1-[(3,3,6,6-tetramethylcyclohexen-1-yl)methylsulfonylmethyl]cyclohexene.
| Compound Name | 3,3,6,6-tetramethyl-1-[(3,3,6,6-tetramethylcyclohexen-1-yl)methylsulfonylmethyl]cyclohexene |
|---|---|
| PubChem CID | 70358951 |
| Molecular Formula | C22H38O2S |
| Molecular Weight | 366.61 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 3,3,6,6-tetramethyl-1-[(3,3,6,6-tetramethylcyclohexen-1-yl)methylsulfonylmethyl]cyclohexene |
| SMILES | CC1(C)C=C(CS(=O)(=O)CC2=CC(C)(C)CCC2(C)C)C(C)(C)CC1 |
| InChI | InChI=1S/C22H38O2S/c1-19(2)9-11-21(5,6)17(13-19)15-25(23,24)16-18-14-20(3,4)10-12-22(18,7)8/h13-14H,9-12,15-16H2,1-8H3 |
| InChIKey | HUBYHHPWTGKWLP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.61 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|