C30H38O2 — CID 70359028
(8S,11R,13S,14S,17R)-13-methyl-11-(4-propan-2-ylphenyl)spiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one (PubChem CID 70359028) has the molecular formula C30H38O2 and a molecular weight of 430.63 g/mol. Its IUPAC name is (8S,11R,13S,14S,17R)-13-methyl-11-(4-propan-2-ylphenyl)spiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one.
| Compound Name | (8S,11R,13S,14S,17R)-13-methyl-11-(4-propan-2-ylphenyl)spiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one |
|---|---|
| PubChem CID | 70359028 |
| Molecular Formula | C30H38O2 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | (8S,11R,13S,14S,17R)-13-methyl-11-(4-propan-2-ylphenyl)spiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one |
| SMILES | CC(C)c1ccc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]34CCCO4)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C30H38O2/c1-19(2)20-5-7-21(8-6-20)26-18-29(3)27(13-15-30(29)14-4-16-32-30)25-11-9-22-17-23(31)10-12-24(22)28(25)26/h5-8,17,19,25-27H,4,9-16,18H2,1-3H3/t25-,26+,27-,29-,30-/m0/s1 |
| InChIKey | AXUCTDGMPHFDRX-ZHAKMVSLSA-N |
| XLogP | 7.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |