C19H22N2O2 — CID 703596
2,2-diethyl-3-(4-methoxyphenyl)-1H-quinazolin-4-one (PubChem CID 703596) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2,2-diethyl-3-(4-methoxyphenyl)-1H-quinazolin-4-one.
| Compound Name | 2,2-diethyl-3-(4-methoxyphenyl)-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 703596 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2,2-diethyl-3-(4-methoxyphenyl)-1H-quinazolin-4-one |
| SMILES | CCC1(CC)Nc2ccccc2C(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H22N2O2/c1-4-19(5-2)20-17-9-7-6-8-16(17)18(22)21(19)14-10-12-15(23-3)13-11-14/h6-13,20H,4-5H2,1-3H3 |
| InChIKey | SFNQOGDRQDZZFF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |