C47H90N10 — CID 70359638
2-N,2-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-N,6-N-bis[1-(1,2,2,6,6-pentamethylpiperidin-4-yl)ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 70359638) has the molecular formula C47H90N10 and a molecular weight of 795.31 g/mol. Its IUPAC name is 2-N,2-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-N,6-N-bis[1-(1,2,2,6,6-pentamethylpiperidin-4-yl)ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-N,6-N-bis[1-(1,2,2,6,6-pentamethylpiperidin-4-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 70359638 |
| Molecular Formula | C47H90N10 |
| Molecular Weight | 795.31 g/mol |
| Exact Mass | 794.73 |
| IUPAC Name | 2-N,2-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-N,6-N-bis[1-(1,2,2,6,6-pentamethylpiperidin-4-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(Nc1nc(NC(C)C2CC(C)(C)N(C)C(C)(C)C2)nc(N(C2CC(C)(C)N(C)C(C)(C)C2)C2CC(C)(C)N(C)C(C)(C)C2)n1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C47H90N10/c1-31(33-23-40(3,4)53(19)41(5,6)24-33)48-37-50-38(49-32(2)34-25-42(7,8)54(20)43(9,10)26-34)52-39(51-37)57(35-27-44(11,12)55(21)45(13,14)28-35)36-29-46(15,16)56(22)47(17,18)30-36/h31-36H,23-30H2,1-22H3,(H2,48,49,50,51,52) |
| InChIKey | FRQDJMMJKTXJNO-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 78.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.31 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |