C14H20O10 — CID 70359660
1-hydroxy-1-[(2R,3R,4S,5R)-3,4,5-triacetyl-3,4,5,6-tetrahydroxyoxan-2-yl]propan-2-one (PubChem CID 70359660) has the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. Its IUPAC name is 1-hydroxy-1-[(2R,3R,4S,5R)-3,4,5-triacetyl-3,4,5,6-tetrahydroxyoxan-2-yl]propan-2-one.
| Compound Name | 1-hydroxy-1-[(2R,3R,4S,5R)-3,4,5-triacetyl-3,4,5,6-tetrahydroxyoxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 70359660 |
| Molecular Formula | C14H20O10 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-hydroxy-1-[(2R,3R,4S,5R)-3,4,5-triacetyl-3,4,5,6-tetrahydroxyoxan-2-yl]propan-2-one |
| SMILES | CC(=O)C(O)[C@H]1OC(O)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C14H20O10/c1-5(15)9(19)10-12(21,6(2)16)14(23,8(4)18)13(22,7(3)17)11(20)24-10/h9-11,19-23H,1-4H3/t9?,10-,11?,12-,13+,14+/m1/s1 |
| InChIKey | CKCRUEKHEVDQDC-GCYFGFEUSA-N |
| XLogP | -3.39 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |