C14H24O5 — CID 70359939
methyl 7-[(4R,5S)-4-hydroxy-2,2-dimethyl-1,3-dioxan-5-yl]hept-5-enoate (PubChem CID 70359939) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is methyl 7-[(4R,5S)-4-hydroxy-2,2-dimethyl-1,3-dioxan-5-yl]hept-5-enoate.
| Compound Name | methyl 7-[(4R,5S)-4-hydroxy-2,2-dimethyl-1,3-dioxan-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 70359939 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | methyl 7-[(4R,5S)-4-hydroxy-2,2-dimethyl-1,3-dioxan-5-yl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@H]1COC(C)(C)O[C@H]1O |
| InChI | InChI=1S/C14H24O5/c1-14(2)18-10-11(13(16)19-14)8-6-4-5-7-9-12(15)17-3/h4,6,11,13,16H,5,7-10H2,1-3H3/t11-,13+/m0/s1 |
| InChIKey | SZOIMAAMFNGASP-WCQYABFASA-N |
| XLogP | 1.99 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|