C17H25N — CID 70359979
6-pentyl-1,2,3,5,6,6a-hexahydropyrrolo[2,1-a]isoquinoline (PubChem CID 70359979) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 6-pentyl-1,2,3,5,6,6a-hexahydropyrrolo[2,1-a]isoquinoline.
| Compound Name | 6-pentyl-1,2,3,5,6,6a-hexahydropyrrolo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 70359979 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 6-pentyl-1,2,3,5,6,6a-hexahydropyrrolo[2,1-a]isoquinoline |
| SMILES | CCCCCC1CN2CCCC2=C2C=CC=CC21 |
| InChI | InChI=1S/C17H25N/c1-2-3-4-8-14-13-18-12-7-11-17(18)16-10-6-5-9-15(14)16/h5-6,9-10,14-15H,2-4,7-8,11-13H2,1H3 |
| InChIKey | YHBAUOADLIKVCZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|