About diphenylmethanamine
diphenylmethanamine (PubChem CID 7036) has the molecular formula C13H13N
and a molecular weight of 183.25 g/mol. Its IUPAC name is diphenylmethanamine.
Molecular Properties
| Compound Name | diphenylmethanamine |
| PubChem CID | 7036 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | diphenylmethanamine |
| SMILES | NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H13N/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,14H2 |
| InChIKey | MGHPNCMVUAKAIE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze diphenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanamine?
The IUPAC name of diphenylmethanamine (CID 7036) is diphenylmethanamine.
What is the SMILES notation for diphenylmethanamine?
The canonical SMILES for diphenylmethanamine is NC(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanamine?
The InChIKey is MGHPNCMVUAKAIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,14H2.
What are the key properties of diphenylmethanamine?
diphenylmethanamine has a molecular weight of 183.25 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanamine is sourced from PubChem (CID 7036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).