C15H19FN2O8 — CID 70360605
1-[(2R,3R,4R,5R)-4,5-diacetyl-3-fluoro-4,5-dihydroxy-2-methoxyoxan-3-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 70360605) has the molecular formula C15H19FN2O8 and a molecular weight of 374.32 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-4,5-diacetyl-3-fluoro-4,5-dihydroxy-2-methoxyoxan-3-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-4,5-diacetyl-3-fluoro-4,5-dihydroxy-2-methoxyoxan-3-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70360605 |
| Molecular Formula | C15H19FN2O8 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-4,5-diacetyl-3-fluoro-4,5-dihydroxy-2-methoxyoxan-3-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CO[C@@H]1OC[C@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@]1(F)n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H19FN2O8/c1-7-5-18(12(22)17-10(7)21)15(16)11(25-4)26-6-13(23,8(2)19)14(15,24)9(3)20/h5,11,23-24H,6H2,1-4H3,(H,17,21,22)/t11-,13+,14+,15-/m1/s1 |
| InChIKey | HIFWKNMSNBMFAO-UQOMUDLDSA-N |
| XLogP | -1.89 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |