C16H29NO3 — CID 70361014
3'-(methoxymethyl)-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline] (PubChem CID 70361014) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is 3'-(methoxymethyl)-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline].
| Compound Name | 3'-(methoxymethyl)-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline] |
|---|---|
| PubChem CID | 70361014 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 3'-(methoxymethyl)-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline] |
| SMILES | CCCN1CC(COC)CC2CC3(CCC21)OCCO3 |
| InChI | InChI=1S/C16H29NO3/c1-3-6-17-11-13(12-18-2)9-14-10-16(5-4-15(14)17)19-7-8-20-16/h13-15H,3-12H2,1-2H3 |
| InChIKey | OPWLLZRADXOECD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |