C12H20N2O — CID 70361402
4-pentyl-2,4a,5,6,7,7a-hexahydrocyclopenta[d]pyridazin-1-one (PubChem CID 70361402) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-pentyl-2,4a,5,6,7,7a-hexahydrocyclopenta[d]pyridazin-1-one.
| Compound Name | 4-pentyl-2,4a,5,6,7,7a-hexahydrocyclopenta[d]pyridazin-1-one |
|---|---|
| PubChem CID | 70361402 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 4-pentyl-2,4a,5,6,7,7a-hexahydrocyclopenta[d]pyridazin-1-one |
| SMILES | CCCCCC1=NNC(=O)C2CCCC12 |
| InChI | InChI=1S/C12H20N2O/c1-2-3-4-8-11-9-6-5-7-10(9)12(15)14-13-11/h9-10H,2-8H2,1H3,(H,14,15) |
| InChIKey | OIJXIGWKQCJQKV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|