C10H18O2S — CID 70361414
(3aR,6R,7aR)-3,3,6-trimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d]oxathiole 2-oxide (PubChem CID 70361414) has the molecular formula C10H18O2S and a molecular weight of 202.32 g/mol. Its IUPAC name is (3aR,6R,7aR)-3,3,6-trimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d]oxathiole 2-oxide.
| Compound Name | (3aR,6R,7aR)-3,3,6-trimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d]oxathiole 2-oxide |
|---|---|
| PubChem CID | 70361414 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (3aR,6R,7aR)-3,3,6-trimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d]oxathiole 2-oxide |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)OS(=O)C2(C)C |
| InChI | InChI=1S/C10H18O2S/c1-7-4-5-8-9(6-7)12-13(11)10(8,2)3/h7-9H,4-6H2,1-3H3/t7-,8-,9-,13?/m1/s1 |
| InChIKey | PXLNIHJTTWRKDE-LDFRESITSA-N |
| XLogP | 2.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |