About 2,5-bis[amino-(4-tert-butylcyclohexyl)methyl]naphthalene-1,6-diol
2,5-bis[amino-(4-tert-butylcyclohexyl)methyl]naphthalene-1,6-diol (PubChem CID 70361471) has the molecular formula C32H50N2O2
and a molecular weight of 494.76 g/mol. Its IUPAC name is 2,5-bis[amino-(4-tert-butylcyclohexyl)methyl]naphthalene-1,6-diol.
Molecular Properties
| Compound Name | 2,5-bis[amino-(4-tert-butylcyclohexyl)methyl]naphthalene-1,6-diol |
| PubChem CID | 70361471 |
| Molecular Formula | C32H50N2O2 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.39 |
| IUPAC Name | 2,5-bis[amino-(4-tert-butylcyclohexyl)methyl]naphthalene-1,6-diol |
| SMILES | CC(C)(C)C1CCC(C(N)c2ccc3c(C(N)C4CCC(C(C)(C)C)CC4)c(O)ccc3c2O)CC1 |
| InChI | InChI=1S/C32H50N2O2/c1-31(2,3)21-11-7-19(8-12-21)28(33)25-16-15-23-24(30(25)36)17-18-26(35)27(23)29(34)20-9-13-22(14-10-20)32(4,5)6/h15-22,28-29,35-36H,7-14,33-34H2,1-6H3 |
| InChIKey | IUUNIQBWBPWVML-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis[amino-(4-tert-butylcyclohexyl)methyl]naphthalene-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis[amino-(4-tert-butylcyclohexyl)methyl]naphthalene-1,6-diol?
The IUPAC name of 2,5-bis[amino-(4-tert-butylcyclohexyl)methyl]naphthalene-1,6-diol (CID 70361471) is 2,5-bis[amino-(4-tert-butylcyclohexyl)methyl]naphthalene-1,6-diol.
What is the SMILES notation for 2,5-bis[amino-(4-tert-butylcyclohexyl)methyl]naphthalene-1,6-diol?
The canonical SMILES for 2,5-bis[amino-(4-tert-butylcyclohexyl)methyl]naphthalene-1,6-diol is CC(C)(C)C1CCC(C(N)c2ccc3c(C(N)C4CCC(C(C)(C)C)CC4)c(O)ccc3c2O)CC1.
What is the InChIKey of 2,5-bis[amino-(4-tert-butylcyclohexyl)methyl]naphthalene-1,6-diol?
The InChIKey is IUUNIQBWBPWVML-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H50N2O2/c1-31(2,3)21-11-7-19(8-12-21)28(33)25-16-15-23-24(30(25)36)17-18-26(35)27(23)29(34)20-9-13-22(14-10-20)32(4,5)6/h15-22,28-29,35-36H,7-14,33-34H2,1-6H3.
What are the key properties of 2,5-bis[amino-(4-tert-butylcyclohexyl)methyl]naphthalene-1,6-diol?
2,5-bis[amino-(4-tert-butylcyclohexyl)methyl]naphthalene-1,6-diol has a molecular weight of 494.76 g/mol, XLogP of 7.96, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis[amino-(4-tert-butylcyclohexyl)methyl]naphthalene-1,6-diol is sourced from PubChem (CID 70361471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).