About 5-chloro-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-1-methylbenzimidazole
5-chloro-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-1-methylbenzimidazole (PubChem CID 70361530) has the molecular formula C16H16ClN3O3S
and a molecular weight of 365.84 g/mol. Its IUPAC name is 5-chloro-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-1-methylbenzimidazole.
Molecular Properties
| Compound Name | 5-chloro-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-1-methylbenzimidazole |
| PubChem CID | 70361530 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 5-chloro-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-1-methylbenzimidazole |
| SMILES | COc1ccnc(CS(=O)c2nc3cc(Cl)ccc3n2C)c1OC |
| InChI | InChI=1S/C16H16ClN3O3S/c1-20-13-5-4-10(17)8-11(13)19-16(20)24(21)9-12-15(23-3)14(22-2)6-7-18-12/h4-8H,9H2,1-3H3 |
| InChIKey | NRKPHGZXDBKYCM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-1-methylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-1-methylbenzimidazole?
The IUPAC name of 5-chloro-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-1-methylbenzimidazole (CID 70361530) is 5-chloro-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-1-methylbenzimidazole.
What is the SMILES notation for 5-chloro-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-1-methylbenzimidazole?
The canonical SMILES for 5-chloro-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-1-methylbenzimidazole is COc1ccnc(CS(=O)c2nc3cc(Cl)ccc3n2C)c1OC.
What is the InChIKey of 5-chloro-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-1-methylbenzimidazole?
The InChIKey is NRKPHGZXDBKYCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN3O3S/c1-20-13-5-4-10(17)8-11(13)19-16(20)24(21)9-12-15(23-3)14(22-2)6-7-18-12/h4-8H,9H2,1-3H3.
What are the key properties of 5-chloro-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-1-methylbenzimidazole?
5-chloro-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-1-methylbenzimidazole has a molecular weight of 365.84 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-1-methylbenzimidazole is sourced from PubChem (CID 70361530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).