About 1-ethyl-2,3-dimethoxy-4-methyl-7-oxabicyclo[2.2.1]hept-2-ene
1-ethyl-2,3-dimethoxy-4-methyl-7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 70361937) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethoxy-4-methyl-7-oxabicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | 1-ethyl-2,3-dimethoxy-4-methyl-7-oxabicyclo[2.2.1]hept-2-ene |
| PubChem CID | 70361937 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 1-ethyl-2,3-dimethoxy-4-methyl-7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | CCC12CCC(C)(O1)C(OC)=C2OC |
| InChI | InChI=1S/C11H18O3/c1-5-11-7-6-10(2,14-11)8(12-3)9(11)13-4/h5-7H2,1-4H3 |
| InChIKey | ULVIBDQXVAMLKR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-2,3-dimethoxy-4-methyl-7-oxabicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,3-dimethoxy-4-methyl-7-oxabicyclo[2.2.1]hept-2-ene?
The IUPAC name of 1-ethyl-2,3-dimethoxy-4-methyl-7-oxabicyclo[2.2.1]hept-2-ene (CID 70361937) is 1-ethyl-2,3-dimethoxy-4-methyl-7-oxabicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for 1-ethyl-2,3-dimethoxy-4-methyl-7-oxabicyclo[2.2.1]hept-2-ene?
The canonical SMILES for 1-ethyl-2,3-dimethoxy-4-methyl-7-oxabicyclo[2.2.1]hept-2-ene is CCC12CCC(C)(O1)C(OC)=C2OC.
What is the InChIKey of 1-ethyl-2,3-dimethoxy-4-methyl-7-oxabicyclo[2.2.1]hept-2-ene?
The InChIKey is ULVIBDQXVAMLKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c1-5-11-7-6-10(2,14-11)8(12-3)9(11)13-4/h5-7H2,1-4H3.
What are the key properties of 1-ethyl-2,3-dimethoxy-4-methyl-7-oxabicyclo[2.2.1]hept-2-ene?
1-ethyl-2,3-dimethoxy-4-methyl-7-oxabicyclo[2.2.1]hept-2-ene has a molecular weight of 198.26 g/mol, XLogP of 2.22, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,3-dimethoxy-4-methyl-7-oxabicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 70361937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).