C36H54ClN3O8 — CID 70361955
7-amino-4,5,6-triethoxy-3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-3H-2-benzofuran-1-one;1-cyclohexyl-N-methylpropan-2-amine;hydrochloride (PubChem CID 70361955) has the molecular formula C36H54ClN3O8 and a molecular weight of 692.29 g/mol. Its IUPAC name is 7-amino-4,5,6-triethoxy-3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-3H-2-benzofuran-1-one;1-cyclohexyl-N-methylpropan-2-amine;hydrochloride.
| Compound Name | 7-amino-4,5,6-triethoxy-3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-3H-2-benzofuran-1-one;1-cyclohexyl-N-methylpropan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 70361955 |
| Molecular Formula | C36H54ClN3O8 |
| Molecular Weight | 692.29 g/mol |
| Exact Mass | 691.36 |
| IUPAC Name | 7-amino-4,5,6-triethoxy-3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-3H-2-benzofuran-1-one;1-cyclohexyl-N-methylpropan-2-amine;hydrochloride |
| SMILES | CCOc1c(N)c2c(c(OCC)c1OCC)C(C1c3c(cc4c(c3OC)OCO4)CCN1C)OC2=O.CNC(C)CC1CCCCC1.Cl |
| InChI | InChI=1S/C26H32N2O8.C10H21N.ClH/c1-6-31-23-17-16(18(27)24(32-7-2)25(23)33-8-3)26(29)36-21(17)19-15-13(9-10-28(19)4)11-14-20(22(15)30-5)35-12-34-14;1-9(11-2)8-10-6-4-3-5-7-10;/h11,19,21H,6-10,12,27H2,1-5H3;9-11H,3-8H2,1-2H3;1H |
| InChIKey | JRLBQRYQOIRQCW-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.29 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|