C20H20N2O5S — CID 70362112
(5R,6S)-3-[4-(4-aminophenoxy)phenyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid (PubChem CID 70362112) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is (5R,6S)-3-[4-(4-aminophenoxy)phenyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid.
| Compound Name | (5R,6S)-3-[4-(4-aminophenoxy)phenyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 70362112 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (5R,6S)-3-[4-(4-aminophenoxy)phenyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2CC(C(=O)O)(c3ccc(Oc4ccc(N)cc4)cc3)S[C@H]12 |
| InChI | InChI=1S/C20H20N2O5S/c1-11(23)16-17(24)22-10-20(19(25)26,28-18(16)22)12-2-6-14(7-3-12)27-15-8-4-13(21)5-9-15/h2-9,11,16,18,23H,10,21H2,1H3,(H,25,26)/t11-,16+,18-,20?/m1/s1 |
| InChIKey | NVXICVZELCYODG-PNQNRCJLSA-N |
| XLogP | 2.25 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|