About chlorobenzene;naphthalene
chlorobenzene;naphthalene (PubChem CID 70362178) has the molecular formula C16H13Cl
and a molecular weight of 240.73 g/mol. Its IUPAC name is chlorobenzene;naphthalene.
Molecular Properties
| Compound Name | chlorobenzene;naphthalene |
| PubChem CID | 70362178 |
| Molecular Formula | C16H13Cl |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | chlorobenzene;naphthalene |
| SMILES | Clc1ccccc1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C6H5Cl/c1-2-6-10-8-4-3-7-9(10)5-1;7-6-4-2-1-3-5-6/h1-8H;1-5H |
| InChIKey | BWYUNUSESXAHKB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze chlorobenzene;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;naphthalene?
The IUPAC name of chlorobenzene;naphthalene (CID 70362178) is chlorobenzene;naphthalene.
What is the SMILES notation for chlorobenzene;naphthalene?
The canonical SMILES for chlorobenzene;naphthalene is Clc1ccccc1.c1ccc2ccccc2c1.
What is the InChIKey of chlorobenzene;naphthalene?
The InChIKey is BWYUNUSESXAHKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C6H5Cl/c1-2-6-10-8-4-3-7-9(10)5-1;7-6-4-2-1-3-5-6/h1-8H;1-5H.
What are the key properties of chlorobenzene;naphthalene?
chlorobenzene;naphthalene has a molecular weight of 240.73 g/mol, XLogP of 5.18, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;naphthalene is sourced from PubChem (CID 70362178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).