C10H13N3O5 — CID 70362302
3-methyl-5-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,4-oxadiazole;oxalic acid (PubChem CID 70362302) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is 3-methyl-5-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,4-oxadiazole;oxalic acid.
| Compound Name | 3-methyl-5-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,4-oxadiazole;oxalic acid |
|---|---|
| PubChem CID | 70362302 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-methyl-5-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,4-oxadiazole;oxalic acid |
| SMILES | Cc1noc(C2=CCCNC2)n1.O=C(O)C(=O)O |
| InChI | InChI=1S/C8H11N3O.C2H2O4/c1-6-10-8(12-11-6)7-3-2-4-9-5-7;3-1(4)2(5)6/h3,9H,2,4-5H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | ORWZFVKDTBKDQI-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|