C12H14ClN3O2 — CID 70362659
2-(3,9-dioxa-2,12-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,11-pentaen-7-yl)-N-methylethanamine;hydrochloride (PubChem CID 70362659) has the molecular formula C12H14ClN3O2 and a molecular weight of 267.72 g/mol. Its IUPAC name is 2-(3,9-dioxa-2,12-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,11-pentaen-7-yl)-N-methylethanamine;hydrochloride.
| Compound Name | 2-(3,9-dioxa-2,12-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,11-pentaen-7-yl)-N-methylethanamine;hydrochloride |
|---|---|
| PubChem CID | 70362659 |
| Molecular Formula | C12H14ClN3O2 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-(3,9-dioxa-2,12-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7,11-pentaen-7-yl)-N-methylethanamine;hydrochloride |
| SMILES | CNCCc1ccc2onc3c2c1OCC=N3.Cl |
| InChI | InChI=1S/C12H13N3O2.ClH/c1-13-5-4-8-2-3-9-10-11(8)16-7-6-14-12(10)15-17-9;/h2-3,6,13H,4-5,7H2,1H3;1H |
| InChIKey | YYZXUMSBVNJRTF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |