C12H26Cl4N3O2P — CID 70362725
N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;2-chloro-N-(2-chloroethyl)-N-methylethanamine (PubChem CID 70362725) has the molecular formula C12H26Cl4N3O2P and a molecular weight of 417.15 g/mol. Its IUPAC name is N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;2-chloro-N-(2-chloroethyl)-N-methylethanamine.
| Compound Name | N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;2-chloro-N-(2-chloroethyl)-N-methylethanamine |
|---|---|
| PubChem CID | 70362725 |
| Molecular Formula | C12H26Cl4N3O2P |
| Molecular Weight | 417.15 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;2-chloro-N-(2-chloroethyl)-N-methylethanamine |
| SMILES | CN(CCCl)CCCl.O=P1(NCCCl)OCCCN1CCCl |
| InChI | InChI=1S/C7H15Cl2N2O2P.C5H11Cl2N/c8-2-4-10-14(12)11(6-3-9)5-1-7-13-14;1-8(4-2-6)5-3-7/h1-7H2,(H,10,12);2-5H2,1H3 |
| InChIKey | ZFNKNPIRHIHTES-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.15 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|